About ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate
ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate (PubChem CID 5149875) has the molecular formula C7H12N3O2S+
and a molecular weight of 202.26 g/mol. Its IUPAC name is ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate |
| PubChem CID | 5149875 |
| Molecular Formula | C7H12N3O2S+ |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate |
| SMILES | CCOC(=O)Nc1sn[n+](C)c1C |
| InChI | InChI=1S/C7H11N3O2S/c1-4-12-7(11)8-6-5(2)10(3)9-13-6/h4H2,1-3H3/p+1 |
| InChIKey | ZDRSZODSIFJIET-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate?
The IUPAC name of ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate (CID 5149875) is ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate.
What is the SMILES notation for ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate?
The canonical SMILES for ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate is CCOC(=O)Nc1sn[n+](C)c1C.
What is the InChIKey of ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate?
The InChIKey is ZDRSZODSIFJIET-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H11N3O2S/c1-4-12-7(11)8-6-5(2)10(3)9-13-6/h4H2,1-3H3/p+1.
What are the key properties of ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate?
ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate has a molecular weight of 202.26 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(3,4-dimethylthiadiazol-3-ium-5-yl)carbamate is sourced from PubChem (CID 5149875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).