C23H27N3O3 — CID 51498846
N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)ethyl]-2-ethyl-3-methyl-1H-indole-5-carboxamide (PubChem CID 51498846) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)ethyl]-2-ethyl-3-methyl-1H-indole-5-carboxamide.
| Compound Name | N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)ethyl]-2-ethyl-3-methyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 51498846 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)ethyl]-2-ethyl-3-methyl-1H-indole-5-carboxamide |
| SMILES | CCc1[nH]c2ccc(C(=O)NC[C@@H](c3ccc4c(c3)OCO4)N(C)C)cc2c1C |
| InChI | InChI=1S/C23H27N3O3/c1-5-18-14(2)17-10-16(6-8-19(17)25-18)23(27)24-12-20(26(3)4)15-7-9-21-22(11-15)29-13-28-21/h6-11,20,25H,5,12-13H2,1-4H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | HISSEDXBQZJDRK-FQEVSTJZSA-N |
| XLogP | 3.80 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|