C22H23N3O2 — CID 51498992
N-[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]-2,3-dimethyl-1H-indole-6-carboxamide (PubChem CID 51498992) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]-2,3-dimethyl-1H-indole-6-carboxamide.
| Compound Name | N-[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]-2,3-dimethyl-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 51498992 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]-2,3-dimethyl-1H-indole-6-carboxamide |
| SMILES | CC(=O)N1c2ccc(NC(=O)c3ccc4c(C)c(C)[nH]c4c3)cc2C[C@@H]1C |
| InChI | InChI=1S/C22H23N3O2/c1-12-9-17-10-18(6-8-21(17)25(12)15(4)26)24-22(27)16-5-7-19-13(2)14(3)23-20(19)11-16/h5-8,10-12,23H,9H2,1-4H3,(H,24,27)/t12-/m0/s1 |
| InChIKey | UJVRYWXDXIVBGG-LBPRGKRZSA-N |
| XLogP | 4.33 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|