About 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole
4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole (PubChem CID 5150094) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole |
| PubChem CID | 5150094 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc(C2Cc3c(C)cc(C)cc3N2)cc1 |
| InChI | InChI=1S/C17H19N/c1-11-4-6-14(7-5-11)16-10-15-13(3)8-12(2)9-17(15)18-16/h4-9,16,18H,10H2,1-3H3 |
| InChIKey | VCFVNYQHTHGKQW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole?
The IUPAC name of 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole (CID 5150094) is 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole?
The canonical SMILES for 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole is Cc1ccc(C2Cc3c(C)cc(C)cc3N2)cc1.
What is the InChIKey of 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole?
The InChIKey is VCFVNYQHTHGKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-11-4-6-14(7-5-11)16-10-15-13(3)8-12(2)9-17(15)18-16/h4-9,16,18H,10H2,1-3H3.
What are the key properties of 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole?
4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole has a molecular weight of 237.35 g/mol, XLogP of 4.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-(4-methylphenyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 5150094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).