C20H24FNO3 — CID 51501596
4-(2-fluorophenyl)-1-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-4-ol (PubChem CID 51501596) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-1-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-4-ol.
| Compound Name | 4-(2-fluorophenyl)-1-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 51501596 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-(2-fluorophenyl)-1-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-4-ol |
| SMILES | COc1cccc([C@H](O)CN2CCC(O)(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C20H24FNO3/c1-25-16-6-4-5-15(13-16)19(23)14-22-11-9-20(24,10-12-22)17-7-2-3-8-18(17)21/h2-8,13,19,23-24H,9-12,14H2,1H3/t19-/m1/s1 |
| InChIKey | WVACHMKWBZWKJU-LJQANCHMSA-N |
| XLogP | 2.85 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |