C28H37NO7 — CID 51502402
3-O-(2-ethoxyethyl) 6-O-methyl (4S,6R,7S)-4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51502402) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is 3-O-(2-ethoxyethyl) 6-O-methyl (4S,6R,7S)-4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-(2-ethoxyethyl) 6-O-methyl (4S,6R,7S)-4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51502402 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-O-(2-ethoxyethyl) 6-O-methyl (4S,6R,7S)-4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCCOc1ccccc1[C@@H]1C(C(=O)OCCOCC)=C(C)NC2=C1C(=O)[C@H](C(=O)OC)[C@@H](C)C2 |
| InChI | InChI=1S/C28H37NO7/c1-6-8-13-35-21-12-10-9-11-19(21)24-23(28(32)36-15-14-34-7-2)18(4)29-20-16-17(3)22(27(31)33-5)26(30)25(20)24/h9-12,17,22,24,29H,6-8,13-16H2,1-5H3/t17-,22+,24+/m0/s1 |
| InChIKey | PXZHVBDNQFBZRQ-VXWZWFMZSA-N |
| XLogP | 4.06 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|