C21H20ClN5OS — CID 515046
5-chloro-2-ethyl-7-methyl-13-[(3-methyl-4-pyridinyl)sulfanylmethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 515046) has the molecular formula C21H20ClN5OS and a molecular weight of 425.95 g/mol. Its IUPAC name is 5-chloro-2-ethyl-7-methyl-13-[(3-methyl-4-pyridinyl)sulfanylmethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 5-chloro-2-ethyl-7-methyl-13-[(3-methyl-4-pyridinyl)sulfanylmethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 515046 |
| Molecular Formula | C21H20ClN5OS |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 5-chloro-2-ethyl-7-methyl-13-[(3-methyl-4-pyridinyl)sulfanylmethyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(CSc3ccncc3C)cc2C(=O)Nc2c(C)cc(Cl)nc21 |
| InChI | InChI=1S/C21H20ClN5OS/c1-4-27-19-15(21(28)26-18-12(2)7-17(22)25-20(18)27)8-14(10-24-19)11-29-16-5-6-23-9-13(16)3/h5-10H,4,11H2,1-3H3,(H,26,28) |
| InChIKey | YVVGGNNZPPNCKL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|