C24H19Cl2FO3 — CID 51505665
(1aR,7R,7aR)-1,1-dichloro-1a-(3,4-dimethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene (PubChem CID 51505665) has the molecular formula C24H19Cl2FO3 and a molecular weight of 445.32 g/mol. Its IUPAC name is (1aR,7R,7aR)-1,1-dichloro-1a-(3,4-dimethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene.
| Compound Name | (1aR,7R,7aR)-1,1-dichloro-1a-(3,4-dimethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene |
|---|---|
| PubChem CID | 51505665 |
| Molecular Formula | C24H19Cl2FO3 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | (1aR,7R,7aR)-1,1-dichloro-1a-(3,4-dimethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene |
| SMILES | COc1ccc([C@]23Oc4ccccc4[C@@H](c4ccc(F)cc4)[C@H]2C3(Cl)Cl)cc1OC |
| InChI | InChI=1S/C24H19Cl2FO3/c1-28-19-12-9-15(13-20(19)29-2)23-22(24(23,25)26)21(14-7-10-16(27)11-8-14)17-5-3-4-6-18(17)30-23/h3-13,21-22H,1-2H3/t21-,22-,23+/m1/s1 |
| InChIKey | JNOOFDPCFXLRJZ-ZLNRFVROSA-N |
| XLogP | 6.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|