C24H18F3N3O5 — CID 51505794
(3S,3'aS,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 51505794) has the molecular formula C24H18F3N3O5 and a molecular weight of 485.42 g/mol. Its IUPAC name is (3S,3'aS,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aS,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 51505794 |
| Molecular Formula | C24H18F3N3O5 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | (3S,3'aS,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)spiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | O=C1[C@@H]2[C@H]3CCCN3[C@@]3(C(=O)Nc4c(C(F)(F)F)cccc43)[C@H]2C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H18F3N3O5/c25-24(26,27)13-4-1-3-12-19(13)28-22(33)23(12)18-17(14-5-2-8-29(14)23)20(31)30(21(18)32)11-6-7-15-16(9-11)35-10-34-15/h1,3-4,6-7,9,14,17-18H,2,5,8,10H2,(H,28,33)/t14-,17-,18-,23-/m1/s1 |
| InChIKey | HYBOVSJRJVUKAN-YMYXXHFHSA-N |
| XLogP | 2.87 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|