C21H18F2N4O3S — CID 515058
N,N-bis(4-fluorophenyl)-N'-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide (PubChem CID 515058) has the molecular formula C21H18F2N4O3S and a molecular weight of 444.46 g/mol. Its IUPAC name is N,N-bis(4-fluorophenyl)-N'-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide.
| Compound Name | N,N-bis(4-fluorophenyl)-N'-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide |
|---|---|
| PubChem CID | 515058 |
| Molecular Formula | C21H18F2N4O3S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N,N-bis(4-fluorophenyl)-N'-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide |
| SMILES | O=c1nc(/N=C/N(c2ccc(F)cc2)c2ccc(F)cc2)ccn1[C@@H]1CS[C@H](CO)O1 |
| InChI | InChI=1S/C21H18F2N4O3S/c22-14-1-5-16(6-2-14)27(17-7-3-15(23)4-8-17)13-24-18-9-10-26(21(29)25-18)19-12-31-20(11-28)30-19/h1-10,13,19-20,28H,11-12H2/b24-13+/t19-,20+/m0/s1 |
| InChIKey | QYGGXGWUPOWLIV-OAHXUYNSSA-N |
| XLogP | 3.60 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|