C29H25N3O3 — CID 51508092
(1S,2R,3R,3aR)-3-cyano-1-(3-methoxybenzoyl)-7-methyl-2-phenyl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide (PubChem CID 51508092) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is (1S,2R,3R,3aR)-3-cyano-1-(3-methoxybenzoyl)-7-methyl-2-phenyl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide.
| Compound Name | (1S,2R,3R,3aR)-3-cyano-1-(3-methoxybenzoyl)-7-methyl-2-phenyl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 51508092 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (1S,2R,3R,3aR)-3-cyano-1-(3-methoxybenzoyl)-7-methyl-2-phenyl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide |
| SMILES | COc1cccc(C(=O)[C@@H]2[C@H](c3ccccc3)[C@@](C#N)(C(N)=O)[C@H]3C=Cc4cc(C)ccc4N23)c1 |
| InChI | InChI=1S/C29H25N3O3/c1-18-11-13-23-20(15-18)12-14-24-29(17-30,28(31)34)25(19-7-4-3-5-8-19)26(32(23)24)27(33)21-9-6-10-22(16-21)35-2/h3-16,24-26H,1-2H3,(H2,31,34)/t24-,25+,26+,29+/m1/s1 |
| InChIKey | DFNBXEFVMBJZGW-NVGWLYTESA-N |
| XLogP | 4.25 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |