methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate

C10H10O3S — CID 5151067

IUPACmethyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate
SMILESCOC(=O)C1CC(=O)c2sccc2C1
InChIInChI=1S/C10H10O3S/c1-13-10(12)7-4-6-2-3-14-9(6)8(11)5-7/h2-3,7H,4-5H2,1H3
InChIKeyJGLXKWSISZFTKF-UHFFFAOYSA-N
MW210.25 g/mol
LogP1.67
Rot. Bonds1

About methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate

methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate (PubChem CID 5151067) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate.

Molecular Properties

Compound Namemethyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate
PubChem CID5151067
Molecular FormulaC10H10O3S
Molecular Weight210.25 g/mol
Exact Mass210.04
IUPAC Namemethyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate
SMILESCOC(=O)C1CC(=O)c2sccc2C1
InChIInChI=1S/C10H10O3S/c1-13-10(12)7-4-6-2-3-14-9(6)8(11)5-7/h2-3,7H,4-5H2,1H3
InChIKeyJGLXKWSISZFTKF-UHFFFAOYSA-N
XLogP1.67
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.25
LogP ≤ 51.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate?
The IUPAC name of methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate (CID 5151067) is methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate.
What is the SMILES notation for methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate?
The canonical SMILES for methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate is COC(=O)C1CC(=O)c2sccc2C1.
What is the InChIKey of methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate?
The InChIKey is JGLXKWSISZFTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S/c1-13-10(12)7-4-6-2-3-14-9(6)8(11)5-7/h2-3,7H,4-5H2,1H3.
What are the key properties of methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate?
methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate has a molecular weight of 210.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylate is sourced from PubChem (CID 5151067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).