C8H10N2O2 — CID 51511573
(5R)-4,5,6,7-tetrahydro-3H-benzimidazol-1-ium-5-carboxylate (PubChem CID 51511573) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (5R)-4,5,6,7-tetrahydro-3H-benzimidazol-1-ium-5-carboxylate.
| Compound Name | (5R)-4,5,6,7-tetrahydro-3H-benzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 51511573 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (5R)-4,5,6,7-tetrahydro-3H-benzimidazol-1-ium-5-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCc2[nH+]c[nH]c2C1 |
| InChI | InChI=1S/C8H10N2O2/c11-8(12)5-1-2-6-7(3-5)10-4-9-6/h4-5H,1-3H2,(H,9,10)(H,11,12)/t5-/m1/s1 |
| InChIKey | LQXRWFGXMQZLIV-RXMQYKEDSA-N |
| XLogP | -1.32 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |