C22H25N7OS2 — CID 51513548
2-ethyl-7-[[4-[(1S,2R)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 51513548) has the molecular formula C22H25N7OS2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 2-ethyl-7-[[4-[(1S,2R)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-ethyl-7-[[4-[(1S,2R)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 51513548 |
| Molecular Formula | C22H25N7OS2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-ethyl-7-[[4-[(1S,2R)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCc1nn2c(=O)cc(CSc3nnc(-c4cccnc4)n3[C@H]3CCCC[C@H]3C)nc2s1 |
| InChI | InChI=1S/C22H25N7OS2/c1-3-18-27-29-19(30)11-16(24-21(29)32-18)13-31-22-26-25-20(15-8-6-10-23-12-15)28(22)17-9-5-4-7-14(17)2/h6,8,10-12,14,17H,3-5,7,9,13H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | PIYMPOBUMUKDQM-PBHICJAKSA-N |
| XLogP | 4.41 |
| TPSA | 90.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |