C7H10N4O3 — CID 5151376
6-morpholin-4-yl-1H-1,3,5-triazine-2,4-dione (PubChem CID 5151376) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 6-morpholin-4-yl-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-morpholin-4-yl-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 5151376 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 6-morpholin-4-yl-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(N2CCOCC2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N4O3/c12-6-8-5(9-7(13)10-6)11-1-3-14-4-2-11/h1-4H2,(H2,8,9,10,12,13) |
| InChIKey | UZHKDSIOLBEZIH-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |