C21H16ClN3O4S — CID 51513875
2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(5-chloro-1-benzofuran-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 51513875) has the molecular formula C21H16ClN3O4S and a molecular weight of 441.90 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(5-chloro-1-benzofuran-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(5-chloro-1-benzofuran-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 51513875 |
| Molecular Formula | C21H16ClN3O4S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[4-(5-chloro-1-benzofuran-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)Nc1nc(-c2cc3cc(Cl)ccc3o2)cs1 |
| InChI | InChI=1S/C21H16ClN3O4S/c22-12-5-6-16-11(7-12)8-17(29-16)15-10-30-21(23-15)24-18(26)9-25-19(27)13-3-1-2-4-14(13)20(25)28/h1-2,5-8,10,13-14H,3-4,9H2,(H,23,24,26)/t13-,14-/m1/s1 |
| InChIKey | FQJVJYUGRRVCNR-ZIAGYGMSSA-N |
| XLogP | 4.10 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|