About 1-cyclohexyl-3-hexylurea
1-cyclohexyl-3-hexylurea (PubChem CID 5151394) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-hexylurea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-hexylurea |
| PubChem CID | 5151394 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-cyclohexyl-3-hexylurea |
| SMILES | CCCCCCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H26N2O/c1-2-3-4-8-11-14-13(16)15-12-9-6-5-7-10-12/h12H,2-11H2,1H3,(H2,14,15,16) |
| InChIKey | QZDGGCAVTQECFB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-hexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-hexylurea?
The IUPAC name of 1-cyclohexyl-3-hexylurea (CID 5151394) is 1-cyclohexyl-3-hexylurea.
What is the SMILES notation for 1-cyclohexyl-3-hexylurea?
The canonical SMILES for 1-cyclohexyl-3-hexylurea is CCCCCCNC(=O)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-hexylurea?
The InChIKey is QZDGGCAVTQECFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-2-3-4-8-11-14-13(16)15-12-9-6-5-7-10-12/h12H,2-11H2,1H3,(H2,14,15,16).
What are the key properties of 1-cyclohexyl-3-hexylurea?
1-cyclohexyl-3-hexylurea has a molecular weight of 226.36 g/mol, XLogP of 3.20, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-hexylurea is sourced from PubChem (CID 5151394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).