C23H21NO5S — CID 515153
2-[4-[3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]phenyl]sulfonylacetic acid (PubChem CID 515153) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[4-[3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]phenyl]sulfonylacetic acid.
| Compound Name | 2-[4-[3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]phenyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 515153 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[4-[3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]phenyl]sulfonylacetic acid |
| SMILES | C[C@@H](NC(=O)c1cccc(-c2ccc(S(=O)(=O)CC(=O)O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO5S/c1-16(17-6-3-2-4-7-17)24-23(27)20-9-5-8-19(14-20)18-10-12-21(13-11-18)30(28,29)15-22(25)26/h2-14,16H,15H2,1H3,(H,24,27)(H,25,26)/t16-/m1/s1 |
| InChIKey | PIOOGZRVKAYOEW-MRXNPFEDSA-N |
| XLogP | 3.70 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |