C16H18N2S — CID 5151557
4-ethylsulfanyl-2-phenyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 5151557) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 4-ethylsulfanyl-2-phenyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-ethylsulfanyl-2-phenyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 5151557 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-ethylsulfanyl-2-phenyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CCSc1nc(-c2ccccc2)nc2c1CCCC2 |
| InChI | InChI=1S/C16H18N2S/c1-2-19-16-13-10-6-7-11-14(13)17-15(18-16)12-8-4-3-5-9-12/h3-5,8-9H,2,6-7,10-11H2,1H3 |
| InChIKey | UJOFMOBGBIMVIK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |