About 1-phenoxathiin-2-ylethyl acetate
1-phenoxathiin-2-ylethyl acetate (PubChem CID 515187) has the molecular formula C16H14O3S
and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-phenoxathiin-2-ylethyl acetate.
Molecular Properties
| Compound Name | 1-phenoxathiin-2-ylethyl acetate |
| PubChem CID | 515187 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-phenoxathiin-2-ylethyl acetate |
| SMILES | CC(=O)OC(C)c1ccc2c(c1)Sc1ccccc1O2 |
| InChI | InChI=1S/C16H14O3S/c1-10(18-11(2)17)12-7-8-14-16(9-12)20-15-6-4-3-5-13(15)19-14/h3-10H,1-2H3 |
| InChIKey | SLFCTKKDJIGNBV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenoxathiin-2-ylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxathiin-2-ylethyl acetate?
The IUPAC name of 1-phenoxathiin-2-ylethyl acetate (CID 515187) is 1-phenoxathiin-2-ylethyl acetate.
What is the SMILES notation for 1-phenoxathiin-2-ylethyl acetate?
The canonical SMILES for 1-phenoxathiin-2-ylethyl acetate is CC(=O)OC(C)c1ccc2c(c1)Sc1ccccc1O2.
What is the InChIKey of 1-phenoxathiin-2-ylethyl acetate?
The InChIKey is SLFCTKKDJIGNBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3S/c1-10(18-11(2)17)12-7-8-14-16(9-12)20-15-6-4-3-5-13(15)19-14/h3-10H,1-2H3.
What are the key properties of 1-phenoxathiin-2-ylethyl acetate?
1-phenoxathiin-2-ylethyl acetate has a molecular weight of 286.35 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxathiin-2-ylethyl acetate is sourced from PubChem (CID 515187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).