About 2-(2-methylphenyl)-1,3-dihydroisoindole
2-(2-methylphenyl)-1,3-dihydroisoindole (PubChem CID 5152025) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)-1,3-dihydroisoindole |
| PubChem CID | 5152025 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-dihydroisoindole |
| SMILES | Cc1ccccc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H15N/c1-12-6-2-5-9-15(12)16-10-13-7-3-4-8-14(13)11-16/h2-9H,10-11H2,1H3 |
| InChIKey | LZYOXONVZCNYGR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylphenyl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)-1,3-dihydroisoindole?
The IUPAC name of 2-(2-methylphenyl)-1,3-dihydroisoindole (CID 5152025) is 2-(2-methylphenyl)-1,3-dihydroisoindole.
What is the SMILES notation for 2-(2-methylphenyl)-1,3-dihydroisoindole?
The canonical SMILES for 2-(2-methylphenyl)-1,3-dihydroisoindole is Cc1ccccc1N1Cc2ccccc2C1.
What is the InChIKey of 2-(2-methylphenyl)-1,3-dihydroisoindole?
The InChIKey is LZYOXONVZCNYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-12-6-2-5-9-15(12)16-10-13-7-3-4-8-14(13)11-16/h2-9H,10-11H2,1H3.
What are the key properties of 2-(2-methylphenyl)-1,3-dihydroisoindole?
2-(2-methylphenyl)-1,3-dihydroisoindole has a molecular weight of 209.29 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)-1,3-dihydroisoindole is sourced from PubChem (CID 5152025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).