C16H25NO2 — CID 51521314
(2Z)-N,N-diethyl-2-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetamide (PubChem CID 51521314) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (2Z)-N,N-diethyl-2-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetamide.
| Compound Name | (2Z)-N,N-diethyl-2-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetamide |
|---|---|
| PubChem CID | 51521314 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (2Z)-N,N-diethyl-2-[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetamide |
| SMILES | CCN(CC)C(=O)/C=C1\C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C16H25NO2/c1-6-17(7-2)13(18)10-11-12-8-9-16(5,14(11)19)15(12,3)4/h10,12H,6-9H2,1-5H3/b11-10-/t12-,16+/m1/s1 |
| InChIKey | ULDRIUWGHBQBBL-FKQGJUFDSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|