C10H20NO3S+ — CID 5152228
cyclohexyl-(4-hydroxy-1,1-dioxothiolan-3-yl)azanium (PubChem CID 5152228) has the molecular formula C10H20NO3S+ and a molecular weight of 234.34 g/mol. Its IUPAC name is cyclohexyl-(4-hydroxy-1,1-dioxothiolan-3-yl)azanium.
| Compound Name | cyclohexyl-(4-hydroxy-1,1-dioxothiolan-3-yl)azanium |
|---|---|
| PubChem CID | 5152228 |
| Molecular Formula | C10H20NO3S+ |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | cyclohexyl-(4-hydroxy-1,1-dioxothiolan-3-yl)azanium |
| SMILES | O=S1(=O)CC(O)C([NH2+]C2CCCCC2)C1 |
| InChI | InChI=1S/C10H19NO3S/c12-10-7-15(13,14)6-9(10)11-8-4-2-1-3-5-8/h8-12H,1-7H2/p+1 |
| InChIKey | QJXHLODFVYVUCV-UHFFFAOYSA-O |
| XLogP | -0.96 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |