C19H16BrN5 — CID 51522786
(8R,8aS)-6-amino-8-(2-bromophenyl)-2-methyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 51522786) has the molecular formula C19H16BrN5 and a molecular weight of 394.28 g/mol. Its IUPAC name is (8R,8aS)-6-amino-8-(2-bromophenyl)-2-methyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-8-(2-bromophenyl)-2-methyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 51522786 |
| Molecular Formula | C19H16BrN5 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (8R,8aS)-6-amino-8-(2-bromophenyl)-2-methyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3ccccc3Br)[C@@H]2C1 |
| InChI | InChI=1S/C19H16BrN5/c1-25-7-6-12-14(8-21)18(24)19(10-22,11-23)17(15(12)9-25)13-4-2-3-5-16(13)20/h2-6,15,17H,7,9,24H2,1H3/t15-,17-/m1/s1 |
| InChIKey | JYWYZPCDJFDJOE-NVXWUHKLSA-N |
| XLogP | 2.80 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|