C26H27N3O3 — CID 51523005
(3aS,7aS)-2-[(2S)-1-oxo-3-phenyl-1-(2-phenyl-4,5-dihydroimidazol-1-yl)propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 51523005) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2S)-1-oxo-3-phenyl-1-(2-phenyl-4,5-dihydroimidazol-1-yl)propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[(2S)-1-oxo-3-phenyl-1-(2-phenyl-4,5-dihydroimidazol-1-yl)propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 51523005 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (3aS,7aS)-2-[(2S)-1-oxo-3-phenyl-1-(2-phenyl-4,5-dihydroimidazol-1-yl)propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C([C@H](Cc1ccccc1)N1C(=O)[C@H]2CCCC[C@@H]2C1=O)N1CCN=C1c1ccccc1 |
| InChI | InChI=1S/C26H27N3O3/c30-24-20-13-7-8-14-21(20)25(31)29(24)22(17-18-9-3-1-4-10-18)26(32)28-16-15-27-23(28)19-11-5-2-6-12-19/h1-6,9-12,20-22H,7-8,13-17H2/t20-,21-,22-/m0/s1 |
| InChIKey | DZHDHAJSPBXVPP-FKBYEOEOSA-N |
| XLogP | 3.06 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|