About 4-tert-butyl-2,6-diphenylaniline
4-tert-butyl-2,6-diphenylaniline (PubChem CID 5152387) has the molecular formula C22H23N
and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-tert-butyl-2,6-diphenylaniline.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-diphenylaniline |
| PubChem CID | 5152387 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-tert-butyl-2,6-diphenylaniline |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(N)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H23N/c1-22(2,3)18-14-19(16-10-6-4-7-11-16)21(23)20(15-18)17-12-8-5-9-13-17/h4-15H,23H2,1-3H3 |
| InChIKey | QDADOVYTWGTHOZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2,6-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-diphenylaniline?
The IUPAC name of 4-tert-butyl-2,6-diphenylaniline (CID 5152387) is 4-tert-butyl-2,6-diphenylaniline.
What is the SMILES notation for 4-tert-butyl-2,6-diphenylaniline?
The canonical SMILES for 4-tert-butyl-2,6-diphenylaniline is CC(C)(C)c1cc(-c2ccccc2)c(N)c(-c2ccccc2)c1.
What is the InChIKey of 4-tert-butyl-2,6-diphenylaniline?
The InChIKey is QDADOVYTWGTHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N/c1-22(2,3)18-14-19(16-10-6-4-7-11-16)21(23)20(15-18)17-12-8-5-9-13-17/h4-15H,23H2,1-3H3.
What are the key properties of 4-tert-butyl-2,6-diphenylaniline?
4-tert-butyl-2,6-diphenylaniline has a molecular weight of 301.43 g/mol, XLogP of 5.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-diphenylaniline is sourced from PubChem (CID 5152387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).