C20H22N2O4S — CID 51524960
N-[(3S)-1-[2-(benzenesulfonyl)ethyl]-5-ethyl-2-oxo-3H-indol-3-yl]acetamide (PubChem CID 51524960) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[(3S)-1-[2-(benzenesulfonyl)ethyl]-5-ethyl-2-oxo-3H-indol-3-yl]acetamide.
| Compound Name | N-[(3S)-1-[2-(benzenesulfonyl)ethyl]-5-ethyl-2-oxo-3H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 51524960 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[(3S)-1-[2-(benzenesulfonyl)ethyl]-5-ethyl-2-oxo-3H-indol-3-yl]acetamide |
| SMILES | CCc1ccc2c(c1)[C@H](NC(C)=O)C(=O)N2CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-3-15-9-10-18-17(13-15)19(21-14(2)23)20(24)22(18)11-12-27(25,26)16-7-5-4-6-8-16/h4-10,13,19H,3,11-12H2,1-2H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | QKINEHKRWWBTPR-IBGZPJMESA-N |
| XLogP | 2.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |