About [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate
[(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate (PubChem CID 51525250) has the molecular formula C17H12F4N4O2
and a molecular weight of 380.30 g/mol. Its IUPAC name is [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate |
| PubChem CID | 51525250 |
| Molecular Formula | C17H12F4N4O2 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate |
| SMILES | N/C(Cn1c(C(F)(F)F)nc2ccccc21)=N/OC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H12F4N4O2/c18-11-6-2-1-5-10(11)15(26)27-24-14(22)9-25-13-8-4-3-7-12(13)23-16(25)17(19,20)21/h1-8H,9H2,(H2,22,24) |
| InChIKey | YOORJELCBHEUGK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate?
The IUPAC name of [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate (CID 51525250) is [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate.
What is the SMILES notation for [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate?
The canonical SMILES for [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate is N/C(Cn1c(C(F)(F)F)nc2ccccc21)=N/OC(=O)c1ccccc1F.
What is the InChIKey of [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate?
The InChIKey is YOORJELCBHEUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F4N4O2/c18-11-6-2-1-5-10(11)15(26)27-24-14(22)9-25-13-8-4-3-7-12(13)23-16(25)17(19,20)21/h1-8H,9H2,(H2,22,24).
What are the key properties of [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate?
[(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate has a molecular weight of 380.30 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[1-amino-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethylidene]amino] 2-fluorobenzoate is sourced from PubChem (CID 51525250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).