C30H25FN4O3 — CID 51525992
(1S,3R,3aS,6aR)-5-(4-fluorophenyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione (PubChem CID 51525992) has the molecular formula C30H25FN4O3 and a molecular weight of 508.55 g/mol. Its IUPAC name is (1S,3R,3aS,6aR)-5-(4-fluorophenyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione.
| Compound Name | (1S,3R,3aS,6aR)-5-(4-fluorophenyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione |
|---|---|
| PubChem CID | 51525992 |
| Molecular Formula | C30H25FN4O3 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (1S,3R,3aS,6aR)-5-(4-fluorophenyl)-1-(2-methylpropyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione |
| SMILES | CC(C)C[C@@H]1N[C@@]2(c3ccccc3-n3c2nc2ccccc2c3=O)[C@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C30H25FN4O3/c1-16(2)15-22-24-25(28(38)34(27(24)37)18-13-11-17(31)12-14-18)30(33-22)20-8-4-6-10-23(20)35-26(36)19-7-3-5-9-21(19)32-29(30)35/h3-14,16,22,24-25,33H,15H2,1-2H3/t22-,24-,25+,30-/m0/s1 |
| InChIKey | FAJWQPQVTPRPQA-CCPXWOOUSA-N |
| XLogP | 3.91 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|