C22H22N2O7 — CID 51527838
(4S,4aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-10,11,12a-trihydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate (PubChem CID 51527838) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is (4S,4aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-10,11,12a-trihydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate.
| Compound Name | (4S,4aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-10,11,12a-trihydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate |
|---|---|
| PubChem CID | 51527838 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (4S,4aS,12aR)-2-carbamoyl-4-(dimethylazaniumyl)-10,11,12a-trihydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracen-1-olate |
| SMILES | Cc1c2c(c(O)c3c(O)cccc13)C(=O)[C@]1(O)C([O-])=C(C(N)=O)C(=O)[C@@H]([NH+](C)C)[C@@H]1C2 |
| InChI | InChI=1S/C22H22N2O7/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28/h4-6,11,16,25-26,29,31H,7H2,1-3H3,(H2,23,30)/t11-,16-,22-/m0/s1 |
| InChIKey | KTTKGQINVKPHLY-DOCRCCHOSA-N |
| XLogP | -2.16 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|