C25H20N2O6 — CID 51528761
2-[(3R,3aR,6aS)-5-(2-methoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoic acid (PubChem CID 51528761) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is 2-[(3R,3aR,6aS)-5-(2-methoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoic acid.
| Compound Name | 2-[(3R,3aR,6aS)-5-(2-methoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 51528761 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[(3R,3aR,6aS)-5-(2-methoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoic acid |
| SMILES | COc1ccccc1N1C(=O)[C@H]2[C@H](ON(c3ccccc3)[C@H]2c2ccccc2C(=O)O)C1=O |
| InChI | InChI=1S/C25H20N2O6/c1-32-19-14-8-7-13-18(19)26-23(28)20-21(16-11-5-6-12-17(16)25(30)31)27(33-22(20)24(26)29)15-9-3-2-4-10-15/h2-14,20-22H,1H3,(H,30,31)/t20-,21+,22+/m1/s1 |
| InChIKey | PFENJNKAHWXPSP-FSSWDIPSSA-N |
| XLogP | 3.44 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|