C23H23N3O4 — CID 51531780
(3S)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 51531780) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (3S)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51531780 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (3S)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C[C@H](N3CCC(c4nc5ccccc5o4)CC3)C2=O)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-17-6-4-5-16(13-17)26-21(27)14-19(23(26)28)25-11-9-15(10-12-25)22-24-18-7-2-3-8-20(18)30-22/h2-8,13,15,19H,9-12,14H2,1H3/t19-/m0/s1 |
| InChIKey | QQEVROAXUJWYGO-IBGZPJMESA-N |
| XLogP | 3.35 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|