About 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile
4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 51531797) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 51531797 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | CCN(c1c(C#N)c(=O)n(C)c(=O)n1C)C1CCCCC1 |
| InChI | InChI=1S/C15H22N4O2/c1-4-19(11-8-6-5-7-9-11)13-12(10-16)14(20)18(3)15(21)17(13)2/h11H,4-9H2,1-3H3 |
| InChIKey | ABUZUFWGSBWUBK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (CID 51531797) is 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile is CCN(c1c(C#N)c(=O)n(C)c(=O)n1C)C1CCCCC1.
What is the InChIKey of 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
The InChIKey is ABUZUFWGSBWUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-4-19(11-8-6-5-7-9-11)13-12(10-16)14(20)18(3)15(21)17(13)2/h11H,4-9H2,1-3H3.
What are the key properties of 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile?
4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile has a molecular weight of 290.37 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclohexyl(ethyl)amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 51531797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).