C17H25IN2O2 — CID 51532518
N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-iodobenzamide (PubChem CID 51532518) has the molecular formula C17H25IN2O2 and a molecular weight of 416.30 g/mol. Its IUPAC name is N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-iodobenzamide.
| Compound Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 51532518 |
| Molecular Formula | C17H25IN2O2 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]-3-iodobenzamide |
| SMILES | C[C@@H]1CN(C(C)(C)CNC(=O)c2cccc(I)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H25IN2O2/c1-12-9-20(10-13(2)22-12)17(3,4)11-19-16(21)14-6-5-7-15(18)8-14/h5-8,12-13H,9-11H2,1-4H3,(H,19,21)/t12-,13+ |
| InChIKey | KIAMZSXIWZIHPG-BETUJISGSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|