C24H23FN4O — CID 51532954
4-(2,5-dimethylpyrrol-1-yl)-N-[(R)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide (PubChem CID 51532954) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[(R)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(R)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 51532954 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[(R)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N[C@H](c2ccc(F)cc2)c2nccn2C)cc1 |
| InChI | InChI=1S/C24H23FN4O/c1-16-4-5-17(2)29(16)21-12-8-19(9-13-21)24(30)27-22(23-26-14-15-28(23)3)18-6-10-20(25)11-7-18/h4-15,22H,1-3H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | LGIGTQCIHYXSOV-JOCHJYFZSA-N |
| XLogP | 4.49 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|