C20H24N2O3 — CID 515337
4,5-dimethyl-2-[4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-1,3-oxazole (PubChem CID 515337) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-1,3-oxazole.
| Compound Name | 4,5-dimethyl-2-[4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 515337 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4,5-dimethyl-2-[4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-1,3-oxazole |
| SMILES | Cc1cc(CCCCCOc2ccc(-c3nc(C)c(C)o3)cc2)on1 |
| InChI | InChI=1S/C20H24N2O3/c1-14-13-19(25-22-14)7-5-4-6-12-23-18-10-8-17(9-11-18)20-21-15(2)16(3)24-20/h8-11,13H,4-7,12H2,1-3H3 |
| InChIKey | LHLWZXSMKWZJOR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|