C21H26N4O5 — CID 51533923
3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylpropanamide (PubChem CID 51533923) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylpropanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 51533923 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylpropanamide |
| SMILES | CCCN(Cc1nnc(-c2ccco2)o1)C(=O)CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C21H26N4O5/c1-2-10-24(13-17-22-23-19(30-17)16-8-5-12-29-16)18(26)9-11-25-20(27)14-6-3-4-7-15(14)21(25)28/h5,8,12,14-15H,2-4,6-7,9-11,13H2,1H3/t14-,15-/m1/s1 |
| InChIKey | IWCZCGDOPASOJG-HUUCEWRRSA-N |
| XLogP | 2.63 |
| TPSA | 109.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|