About (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate
(4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 51536472) has the molecular formula C18H12Cl2FNO4
and a molecular weight of 396.20 g/mol. Its IUPAC name is (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 51536472 |
| Molecular Formula | C18H12Cl2FNO4 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCc1ccc(F)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C18H12Cl2FNO4/c1-9(18(25)26-8-10-2-4-11(21)5-3-10)22-16(23)12-6-14(19)15(20)7-13(12)17(22)24/h2-7,9H,8H2,1H3/t9-/m0/s1 |
| InChIKey | UWAXYHHTSBMVMF-VIFPVBQESA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate (CID 51536472) is (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate is C[C@@H](C(=O)OCc1ccc(F)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O.
What is the InChIKey of (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is UWAXYHHTSBMVMF-VIFPVBQESA-N. The full InChI is InChI=1S/C18H12Cl2FNO4/c1-9(18(25)26-8-10-2-4-11(21)5-3-10)22-16(23)12-6-14(19)15(20)7-13(12)17(22)24/h2-7,9H,8H2,1H3/t9-/m0/s1.
What are the key properties of (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate?
(4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 396.20 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 51536472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).