C26H32ClN3O6 — CID 51536952
[[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoyl]amino] 4-chlorobenzoate (PubChem CID 51536952) has the molecular formula C26H32ClN3O6 and a molecular weight of 518.01 g/mol. Its IUPAC name is [[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoyl]amino] 4-chlorobenzoate.
| Compound Name | [[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoyl]amino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 51536952 |
| Molecular Formula | C26H32ClN3O6 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | [[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoyl]amino] 4-chlorobenzoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)NOC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H32ClN3O6/c1-16(2)21(29-25(34)35-26(3,4)5)23(32)28-20(15-17-9-7-6-8-10-17)22(31)30-36-24(33)18-11-13-19(27)14-12-18/h6-14,16,20-21H,15H2,1-5H3,(H,28,32)(H,29,34)(H,30,31)/t20-,21-/m0/s1 |
| InChIKey | GKFXWKCACBHADI-SFTDATJTSA-N |
| XLogP | 3.80 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|