C19H20FNO5 — CID 51537459
methyl 5-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]methyl]-2-methoxybenzoate (PubChem CID 51537459) has the molecular formula C19H20FNO5 and a molecular weight of 361.37 g/mol. Its IUPAC name is methyl 5-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 51537459 |
| Molecular Formula | C19H20FNO5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl 5-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)[C@H](C)Oc2ccc(F)cc2)ccc1OC |
| InChI | InChI=1S/C19H20FNO5/c1-12(26-15-7-5-14(20)6-8-15)18(22)21-11-13-4-9-17(24-2)16(10-13)19(23)25-3/h4-10,12H,11H2,1-3H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | IIYREFQBUCVWGN-LBPRGKRZSA-N |
| XLogP | 2.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |