About 9H-thioxanthen-9-ol
9H-thioxanthen-9-ol (PubChem CID 5154170) has the molecular formula C13H10OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 9H-thioxanthen-9-ol.
Molecular Properties
| Compound Name | 9H-thioxanthen-9-ol |
| PubChem CID | 5154170 |
| Molecular Formula | C13H10OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 9H-thioxanthen-9-ol |
| SMILES | OC1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C13H10OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13-14H |
| InChIKey | IWNPWQRBFNOGHM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-thioxanthen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-thioxanthen-9-ol?
The IUPAC name of 9H-thioxanthen-9-ol (CID 5154170) is 9H-thioxanthen-9-ol.
What is the SMILES notation for 9H-thioxanthen-9-ol?
The canonical SMILES for 9H-thioxanthen-9-ol is OC1c2ccccc2Sc2ccccc21.
What is the InChIKey of 9H-thioxanthen-9-ol?
The InChIKey is IWNPWQRBFNOGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13-14H.
What are the key properties of 9H-thioxanthen-9-ol?
9H-thioxanthen-9-ol has a molecular weight of 214.29 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-thioxanthen-9-ol is sourced from PubChem (CID 5154170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).