C25H24O7 — CID 51542656
(3S,11R)-3,7,21-trihydroxy-17,17-dimethyl-14-(3-methylbut-2-enyl)-10,12,16-trioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-2-one (PubChem CID 51542656) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is (3S,11R)-3,7,21-trihydroxy-17,17-dimethyl-14-(3-methylbut-2-enyl)-10,12,16-trioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-2-one.
| Compound Name | (3S,11R)-3,7,21-trihydroxy-17,17-dimethyl-14-(3-methylbut-2-enyl)-10,12,16-trioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-2-one |
|---|---|
| PubChem CID | 51542656 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (3S,11R)-3,7,21-trihydroxy-17,17-dimethyl-14-(3-methylbut-2-enyl)-10,12,16-trioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),4(9),5,7,14,18,20-heptaen-2-one |
| SMILES | CC(C)=CCc1c2c(c(O)c3c1O[C@H]1Oc4cc(O)ccc4[C@@]1(O)C3=O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C25H24O7/c1-12(2)5-7-15-20-14(9-10-24(3,4)32-20)19(27)18-21(15)31-23-25(29,22(18)28)16-8-6-13(26)11-17(16)30-23/h5-6,8-11,23,26-27,29H,7H2,1-4H3/t23-,25-/m1/s1 |
| InChIKey | DQNIDSLDXGTEPL-ILBGXUMGSA-N |
| XLogP | 3.97 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|