C15H19Cl3N2O2S — CID 5154373
6-tert-butyl-2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5154373) has the molecular formula C15H19Cl3N2O2S and a molecular weight of 397.76 g/mol. Its IUPAC name is 6-tert-butyl-2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5154373 |
| Molecular Formula | C15H19Cl3N2O2S |
| Molecular Weight | 397.76 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 6-tert-butyl-2-[(2,2,2-trichloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=O)C(Cl)(Cl)Cl)c2C(N)=O)C1 |
| InChI | InChI=1S/C15H19Cl3N2O2S/c1-14(2,3)7-4-5-8-9(6-7)23-12(10(8)11(19)21)20-13(22)15(16,17)18/h7H,4-6H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | XUHSZOMSHWBYLU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|