C23H23ClN2O4S — CID 51545347
3-[(4-chlorophenyl)methylsulfamoyl]-N-(2,4-dimethylphenyl)-4-methoxybenzamide (PubChem CID 51545347) has the molecular formula C23H23ClN2O4S and a molecular weight of 458.97 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfamoyl]-N-(2,4-dimethylphenyl)-4-methoxybenzamide.
| Compound Name | 3-[(4-chlorophenyl)methylsulfamoyl]-N-(2,4-dimethylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 51545347 |
| Molecular Formula | C23H23ClN2O4S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfamoyl]-N-(2,4-dimethylphenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C)cc2C)cc1S(=O)(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O4S/c1-15-4-10-20(16(2)12-15)26-23(27)18-7-11-21(30-3)22(13-18)31(28,29)25-14-17-5-8-19(24)9-6-17/h4-13,25H,14H2,1-3H3,(H,26,27) |
| InChIKey | YAGPHMNQGJSQPF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |