C23H18N4O2 — CID 5155441
2-methoxy-N-(5-methylbenzimidazolo[2,1-a]phthalazin-10-yl)benzamide (PubChem CID 5155441) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-methoxy-N-(5-methylbenzimidazolo[2,1-a]phthalazin-10-yl)benzamide.
| Compound Name | 2-methoxy-N-(5-methylbenzimidazolo[2,1-a]phthalazin-10-yl)benzamide |
|---|---|
| PubChem CID | 5155441 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-methoxy-N-(5-methylbenzimidazolo[2,1-a]phthalazin-10-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2c(c1)nc1c3ccccc3c(C)nn21 |
| InChI | InChI=1S/C23H18N4O2/c1-14-16-7-3-4-8-17(16)22-25-19-13-15(11-12-20(19)27(22)26-14)24-23(28)18-9-5-6-10-21(18)29-2/h3-13H,1-2H3,(H,24,28) |
| InChIKey | LLLHEYMUUZZNBF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |