C68H72N8O8Zn — CID 5155492
zinc 4-[2-[4-[10,15,20-tris[4-(2-morpholin-4-ylethoxy)phenyl]porphyrin-22,24-diid-5-yl]phenoxy]ethyl]morpholine (PubChem CID 5155492) has the molecular formula C68H72N8O8Zn and a molecular weight of 1194.76 g/mol. Its IUPAC name is zinc 4-[2-[4-[10,15,20-tris[4-(2-morpholin-4-ylethoxy)phenyl]porphyrin-22,24-diid-5-yl]phenoxy]ethyl]morpholine.
| Compound Name | zinc 4-[2-[4-[10,15,20-tris[4-(2-morpholin-4-ylethoxy)phenyl]porphyrin-22,24-diid-5-yl]phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 5155492 |
| Molecular Formula | C68H72N8O8Zn |
| Molecular Weight | 1194.76 g/mol |
| Exact Mass | 1192.48 |
| IUPAC Name | zinc 4-[2-[4-[10,15,20-tris[4-(2-morpholin-4-ylethoxy)phenyl]porphyrin-22,24-diid-5-yl]phenoxy]ethyl]morpholine |
| SMILES | C1=Cc2nc1c(-c1ccc(OCCN3CCOCC3)cc1)c1ccc([n-]1)c(-c1ccc(OCCN3CCOCC3)cc1)c1nc(c(-c3ccc(OCCN4CCOCC4)cc3)c3ccc([n-]3)c2-c2ccc(OCCN3CCOCC3)cc2)C=C1.[Zn+2] |
| InChI | InChI=1S/C68H72N8O8.Zn/c1-9-53(81-45-33-73-25-37-77-38-26-73)10-2-49(1)65-57-17-19-59(69-57)66(50-3-11-54(12-4-50)82-46-34-74-27-39-78-40-28-74)61-21-23-63(71-61)68(52-7-15-56(16-8-52)84-48-36-76-31-43-80-44-32-76)64-24-22-62(72-64)67(60-20-18-58(65)70-60)51-5-13-55(14-6-51)83-47-35-75-29-41-79-42-30-75;/h1-24H,25-48H2;/q-2;+2/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64-; |
| InChIKey | NAHBFECRSRCNIC-GIZPQBOTSA-N |
| XLogP | 9.42 |
| TPSA | 140.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1194.76 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|