C16H21N3O4S — CID 51556070
(1S,9S)-N-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide (PubChem CID 51556070) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is (1S,9S)-N-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide.
| Compound Name | (1S,9S)-N-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 51556070 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (1S,9S)-N-[(3R)-1,1-dioxothiolan-3-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C16H21N3O4S/c20-15-3-1-2-14-12-6-11(8-19(14)15)7-18(9-12)16(21)17-13-4-5-24(22,23)10-13/h1-3,11-13H,4-10H2,(H,17,21)/t11-,12+,13-/m1/s1 |
| InChIKey | NGUJOKJTVRDRLD-FRRDWIJNSA-N |
| XLogP | 0.16 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |