C18H16BrN3O2 — CID 5155842
N-(2-bromophenyl)-2-cyano-3-(5-pyrrolidin-1-ylfuran-2-yl)prop-2-enamide (PubChem CID 5155842) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-cyano-3-(5-pyrrolidin-1-ylfuran-2-yl)prop-2-enamide.
| Compound Name | N-(2-bromophenyl)-2-cyano-3-(5-pyrrolidin-1-ylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5155842 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-(2-bromophenyl)-2-cyano-3-(5-pyrrolidin-1-ylfuran-2-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(N2CCCC2)o1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C18H16BrN3O2/c19-15-5-1-2-6-16(15)21-18(23)13(12-20)11-14-7-8-17(24-14)22-9-3-4-10-22/h1-2,5-8,11H,3-4,9-10H2,(H,21,23) |
| InChIKey | UKWIBPYCXZZHDU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_B(2)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|