C24H25ClN4O5 — CID 51561886
2-[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(5-chloro-2-methylphenyl)-5-nitrobenzamide (PubChem CID 51561886) has the molecular formula C24H25ClN4O5 and a molecular weight of 484.94 g/mol. Its IUPAC name is 2-[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(5-chloro-2-methylphenyl)-5-nitrobenzamide.
| Compound Name | 2-[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(5-chloro-2-methylphenyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 51561886 |
| Molecular Formula | C24H25ClN4O5 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(5-chloro-2-methylphenyl)-5-nitrobenzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1cc([N+](=O)[O-])ccc1NCCN1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C24H25ClN4O5/c1-14-6-7-15(25)12-21(14)27-22(30)19-13-16(29(33)34)8-9-20(19)26-10-11-28-23(31)17-4-2-3-5-18(17)24(28)32/h6-9,12-13,17-18,26H,2-5,10-11H2,1H3,(H,27,30)/t17-,18-/m0/s1 |
| InChIKey | ZYNABXIOFZNARH-ROUUACIJSA-N |
| XLogP | 4.40 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|