C18H20N4O2S2 — CID 51562701
1-phenyl-3-[(2R,3S)-3-(phenylcarbamothioylamino)-1,4-dioxan-2-yl]thiourea (PubChem CID 51562701) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-phenyl-3-[(2R,3S)-3-(phenylcarbamothioylamino)-1,4-dioxan-2-yl]thiourea.
| Compound Name | 1-phenyl-3-[(2R,3S)-3-(phenylcarbamothioylamino)-1,4-dioxan-2-yl]thiourea |
|---|---|
| PubChem CID | 51562701 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-phenyl-3-[(2R,3S)-3-(phenylcarbamothioylamino)-1,4-dioxan-2-yl]thiourea |
| SMILES | S=C(Nc1ccccc1)N[C@@H]1OCCO[C@@H]1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N4O2S2/c25-17(19-13-7-3-1-4-8-13)21-15-16(24-12-11-23-15)22-18(26)20-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H2,19,21,25)(H2,20,22,26)/t15-,16+ |
| InChIKey | MFZYZWHTLRFNKW-IYBDPMFKSA-N |
| XLogP | 2.66 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|